C15H23N3OS — CID 79920135
[2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methanol (PubChem CID 79920135) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 79920135 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | [2-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-cyclopropyl-1,3-thiazol-5-yl]methanol |
| SMILES | OCc1sc(N2CCN3CCCCC3C2)nc1C1CC1 |
| InChI | InChI=1S/C15H23N3OS/c19-10-13-14(11-4-5-11)16-15(20-13)18-8-7-17-6-2-1-3-12(17)9-18/h11-12,19H,1-10H2 |
| InChIKey | AIIZBMMNMFNUCL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |