About [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol
[4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 65286588) has the molecular formula C16H28N2OS
and a molecular weight of 296.48 g/mol. Its IUPAC name is [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol.
Molecular Properties
| Compound Name | [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol |
| PubChem CID | 65286588 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC1(C)CCCN(c2nc(C(C)(C)C)c(CO)s2)CC1 |
| InChI | InChI=1S/C16H28N2OS/c1-15(2,3)13-12(11-19)20-14(17-13)18-9-6-7-16(4,5)8-10-18/h19H,6-11H2,1-5H3 |
| InChIKey | CKQDTGBYLZJQTR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol?
The IUPAC name of [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol (CID 65286588) is [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol.
What is the SMILES notation for [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol?
The canonical SMILES for [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol is CC1(C)CCCN(c2nc(C(C)(C)C)c(CO)s2)CC1.
What is the InChIKey of [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol?
The InChIKey is CKQDTGBYLZJQTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2OS/c1-15(2,3)13-12(11-19)20-14(17-13)18-9-6-7-16(4,5)8-10-18/h19H,6-11H2,1-5H3.
What are the key properties of [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol?
[4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol has a molecular weight of 296.48 g/mol, XLogP of 3.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-2-(4,4-dimethylazepan-1-yl)-1,3-thiazol-5-yl]methanol is sourced from PubChem (CID 65286588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).