C17H23N3S — CID 62767498
N-[[2-(1,3-dihydroisoindol-2-yl)-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 62767498) has the molecular formula C17H23N3S and a molecular weight of 301.46 g/mol. Its IUPAC name is N-[[2-(1,3-dihydroisoindol-2-yl)-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(1,3-dihydroisoindol-2-yl)-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62767498 |
| Molecular Formula | C17H23N3S |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | N-[[2-(1,3-dihydroisoindol-2-yl)-4-ethyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(N2Cc3ccccc3C2)nc1CC |
| InChI | InChI=1S/C17H23N3S/c1-3-9-18-10-16-15(4-2)19-17(21-16)20-11-13-7-5-6-8-14(13)12-20/h5-8,18H,3-4,9-12H2,1-2H3 |
| InChIKey | KTGUVLNOSWFNLI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|