C12H15Cl2NO — CID 62773402
1-(cyclopropylamino)-2-(2,5-dichlorophenyl)propan-2-ol (PubChem CID 62773402) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 1-(cyclopropylamino)-2-(2,5-dichlorophenyl)propan-2-ol.
| Compound Name | 1-(cyclopropylamino)-2-(2,5-dichlorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 62773402 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(cyclopropylamino)-2-(2,5-dichlorophenyl)propan-2-ol |
| SMILES | CC(O)(CNC1CC1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO/c1-12(16,7-15-9-3-4-9)10-6-8(13)2-5-11(10)14/h2,5-6,9,15-16H,3-4,7H2,1H3 |
| InChIKey | XFNVASZCOWNBIF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |