C16H36N4 — CID 62773682
N-[2-(4-butan-2-ylpiperazin-1-yl)ethyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 62773682) has the molecular formula C16H36N4 and a molecular weight of 284.49 g/mol. Its IUPAC name is N-[2-(4-butan-2-ylpiperazin-1-yl)ethyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[2-(4-butan-2-ylpiperazin-1-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 62773682 |
| Molecular Formula | C16H36N4 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.29 |
| IUPAC Name | N-[2-(4-butan-2-ylpiperazin-1-yl)ethyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCC(C)N1CCN(CCNCCN(CC)CC)CC1 |
| InChI | InChI=1S/C16H36N4/c1-5-16(4)20-14-12-19(13-15-20)11-9-17-8-10-18(6-2)7-3/h16-17H,5-15H2,1-4H3 |
| InChIKey | YIFNSTZVFSDRBN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|