C15H34N4 — CID 114540396
N',N'-diethyl-N-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 114540396) has the molecular formula C15H34N4 and a molecular weight of 270.46 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 114540396 |
| Molecular Formula | C15H34N4 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.28 |
| IUPAC Name | N',N'-diethyl-N-[2-(3,4,5-trimethylpiperazin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN1CC(C)N(C)C(C)C1 |
| InChI | InChI=1S/C15H34N4/c1-6-18(7-2)10-8-16-9-11-19-12-14(3)17(5)15(4)13-19/h14-16H,6-13H2,1-5H3 |
| InChIKey | QGAZHZXLSBDLCN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|