C16H26N4S — CID 62776397
2-(4-butan-2-ylpiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 62776397) has the molecular formula C16H26N4S and a molecular weight of 306.48 g/mol. Its IUPAC name is 2-(4-butan-2-ylpiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-(4-butan-2-ylpiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 62776397 |
| Molecular Formula | C16H26N4S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-(4-butan-2-ylpiperazin-1-yl)-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | CCC(C)N1CCN(c2nc(C)cc(C)c2C(N)=S)CC1 |
| InChI | InChI=1S/C16H26N4S/c1-5-13(4)19-6-8-20(9-7-19)16-14(15(17)21)11(2)10-12(3)18-16/h10,13H,5-9H2,1-4H3,(H2,17,21) |
| InChIKey | OCXFAWHIHXJCFH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|