C16H19N3S — CID 62779783
3-[methyl(pyridin-4-ylmethyl)amino]-3-phenylpropanethioamide (PubChem CID 62779783) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 3-[methyl(pyridin-4-ylmethyl)amino]-3-phenylpropanethioamide.
| Compound Name | 3-[methyl(pyridin-4-ylmethyl)amino]-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 62779783 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[methyl(pyridin-4-ylmethyl)amino]-3-phenylpropanethioamide |
| SMILES | CN(Cc1ccncc1)C(CC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C16H19N3S/c1-19(12-13-7-9-18-10-8-13)15(11-16(17)20)14-5-3-2-4-6-14/h2-10,15H,11-12H2,1H3,(H2,17,20) |
| InChIKey | CIOGSEDTLQMMSH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|