C17H19ClN2S — CID 62779798
3-[(4-chlorophenyl)methyl-methylamino]-3-phenylpropanethioamide (PubChem CID 62779798) has the molecular formula C17H19ClN2S and a molecular weight of 318.87 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl-methylamino]-3-phenylpropanethioamide.
| Compound Name | 3-[(4-chlorophenyl)methyl-methylamino]-3-phenylpropanethioamide |
|---|---|
| PubChem CID | 62779798 |
| Molecular Formula | C17H19ClN2S |
| Molecular Weight | 318.87 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl-methylamino]-3-phenylpropanethioamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(CC(N)=S)c1ccccc1 |
| InChI | InChI=1S/C17H19ClN2S/c1-20(12-13-7-9-15(18)10-8-13)16(11-17(19)21)14-5-3-2-4-6-14/h2-10,16H,11-12H2,1H3,(H2,19,21) |
| InChIKey | VGVUWXULKARZNO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|