C16H32N2O — CID 62781493
2-(2-aminocyclohexyl)-N,N-dibutylacetamide (PubChem CID 62781493) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-(2-aminocyclohexyl)-N,N-dibutylacetamide.
| Compound Name | 2-(2-aminocyclohexyl)-N,N-dibutylacetamide |
|---|---|
| PubChem CID | 62781493 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | 2-(2-aminocyclohexyl)-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CC1CCCCC1N |
| InChI | InChI=1S/C16H32N2O/c1-3-5-11-18(12-6-4-2)16(19)13-14-9-7-8-10-15(14)17/h14-15H,3-13,17H2,1-2H3 |
| InChIKey | SEOPOOGHYDWDKR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |