C16H19N3S — CID 62781973
4,4-diethyl-N-quinolin-3-yl-5H-1,3-thiazol-2-amine (PubChem CID 62781973) has the molecular formula C16H19N3S and a molecular weight of 285.42 g/mol. Its IUPAC name is 4,4-diethyl-N-quinolin-3-yl-5H-1,3-thiazol-2-amine.
| Compound Name | 4,4-diethyl-N-quinolin-3-yl-5H-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62781973 |
| Molecular Formula | C16H19N3S |
| Molecular Weight | 285.42 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4,4-diethyl-N-quinolin-3-yl-5H-1,3-thiazol-2-amine |
| SMILES | CCC1(CC)CSC(Nc2cnc3ccccc3c2)=N1 |
| InChI | InChI=1S/C16H19N3S/c1-3-16(4-2)11-20-15(19-16)18-13-9-12-7-5-6-8-14(12)17-10-13/h5-10H,3-4,11H2,1-2H3,(H,18,19) |
| InChIKey | RDVSAGAPEUOYRD-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |