C14H13N3S — CID 135416194
N-(pyridin-2-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine (PubChem CID 135416194) has the molecular formula C14H13N3S and a molecular weight of 255.35 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine.
| Compound Name | N-(pyridin-2-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine |
|---|---|
| PubChem CID | 135416194 |
| Molecular Formula | C14H13N3S |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1,4-dihydro-3,1-benzothiazin-2-imine |
| SMILES | c1ccc(C/N=C2/Nc3ccccc3CS2)nc1 |
| InChI | InChI=1S/C14H13N3S/c1-2-7-13-11(5-1)10-18-14(17-13)16-9-12-6-3-4-8-15-12/h1-8H,9-10H2,(H,16,17) |
| InChIKey | XNMRPWZYTMZSDO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|