C13H12N4O — CID 6278267
2-cyano-N-[(Z)-1-(1H-indol-6-yl)ethylideneamino]acetamide (PubChem CID 6278267) has the molecular formula C13H12N4O and a molecular weight of 240.27 g/mol. Its IUPAC name is 2-cyano-N-[(Z)-1-(1H-indol-6-yl)ethylideneamino]acetamide.
| Compound Name | 2-cyano-N-[(Z)-1-(1H-indol-6-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6278267 |
| Molecular Formula | C13H12N4O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-cyano-N-[(Z)-1-(1H-indol-6-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CC#N)c1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C13H12N4O/c1-9(16-17-13(18)4-6-14)11-3-2-10-5-7-15-12(10)8-11/h2-3,5,7-8,15H,4H2,1H3,(H,17,18)/b16-9- |
| InChIKey | XCDWETNZHZNRMY-SXGWCWSVSA-N |
| XLogP | 1.92 |
| TPSA | 81.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|