C11H15F2NO — CID 62784520
2-(3,5-difluorophenoxy)-3-methylbutan-1-amine (PubChem CID 62784520) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-(3,5-difluorophenoxy)-3-methylbutan-1-amine.
| Compound Name | 2-(3,5-difluorophenoxy)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 62784520 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(3,5-difluorophenoxy)-3-methylbutan-1-amine |
| SMILES | CC(C)C(CN)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2NO/c1-7(2)11(6-14)15-10-4-8(12)3-9(13)5-10/h3-5,7,11H,6,14H2,1-2H3 |
| InChIKey | CQBFIFRYBYNOED-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |