C14H19N3O4 — CID 62798498
N-(2-amino-2-oxoethyl)-N-[(2-aminophenyl)methyl]-1,4-dioxane-2-carboxamide (PubChem CID 62798498) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-[(2-aminophenyl)methyl]-1,4-dioxane-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-N-[(2-aminophenyl)methyl]-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 62798498 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-[(2-aminophenyl)methyl]-1,4-dioxane-2-carboxamide |
| SMILES | NC(=O)CN(Cc1ccccc1N)C(=O)C1COCCO1 |
| InChI | InChI=1S/C14H19N3O4/c15-11-4-2-1-3-10(11)7-17(8-13(16)18)14(19)12-9-20-5-6-21-12/h1-4,12H,5-9,15H2,(H2,16,18) |
| InChIKey | PYSAZLXDQSEVLK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|