C18H28O4 — CID 627991
3-nonyl-2,11-dioxatricyclo[4.4.1.01,6]undecane-5,7-dione (PubChem CID 627991) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 3-nonyl-2,11-dioxatricyclo[4.4.1.01,6]undecane-5,7-dione.
| Compound Name | 3-nonyl-2,11-dioxatricyclo[4.4.1.01,6]undecane-5,7-dione |
|---|---|
| PubChem CID | 627991 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-nonyl-2,11-dioxatricyclo[4.4.1.01,6]undecane-5,7-dione |
| SMILES | CCCCCCCCCC1CC(=O)C23OC2(CCCC3=O)O1 |
| InChI | InChI=1S/C18H28O4/c1-2-3-4-5-6-7-8-10-14-13-16(20)18-15(19)11-9-12-17(18,21-14)22-18/h14H,2-13H2,1H3 |
| InChIKey | DDZFRBVIDTWKPO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|