C16H15F4N — CID 62801471
N-[[4-fluoro-3-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine (PubChem CID 62801471) has the molecular formula C16H15F4N and a molecular weight of 297.30 g/mol. Its IUPAC name is N-[[4-fluoro-3-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine.
| Compound Name | N-[[4-fluoro-3-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 62801471 |
| Molecular Formula | C16H15F4N |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N-[[4-fluoro-3-[2-(trifluoromethyl)phenyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(F)c(-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F4N/c1-2-21-10-11-7-8-15(17)13(9-11)12-5-3-4-6-14(12)16(18,19)20/h3-9,21H,2,10H2,1H3 |
| InChIKey | AKLXEUBIDCARQH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |