C12H15N3O5S — CID 62803072
5-methyl-4-[(2-propan-2-ylpyrazol-3-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62803072) has the molecular formula C12H15N3O5S and a molecular weight of 313.34 g/mol. Its IUPAC name is 5-methyl-4-[(2-propan-2-ylpyrazol-3-yl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[(2-propan-2-ylpyrazol-3-yl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62803072 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 5-methyl-4-[(2-propan-2-ylpyrazol-3-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1S(=O)(=O)Nc1ccnn1C(C)C |
| InChI | InChI=1S/C12H15N3O5S/c1-7(2)15-11(4-5-13-15)14-21(18,19)10-6-9(12(16)17)20-8(10)3/h4-7,14H,1-3H3,(H,16,17) |
| InChIKey | UYDCRIGQUSYEKY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 114.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |