C12H21NO2 — CID 62803653
cyclohepten-1-yl(1,4-dioxan-2-yl)methanamine (PubChem CID 62803653) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is cyclohepten-1-yl(1,4-dioxan-2-yl)methanamine.
| Compound Name | cyclohepten-1-yl(1,4-dioxan-2-yl)methanamine |
|---|---|
| PubChem CID | 62803653 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | cyclohepten-1-yl(1,4-dioxan-2-yl)methanamine |
| SMILES | NC(C1=CCCCCC1)C1COCCO1 |
| InChI | InChI=1S/C12H21NO2/c13-12(11-9-14-7-8-15-11)10-5-3-1-2-4-6-10/h5,11-12H,1-4,6-9,13H2 |
| InChIKey | GJMINTNWUNGMAQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|