C13H23NO2 — CID 62803654
1-(cyclohepten-1-yl)-1-(1,4-dioxan-2-yl)-N-methylmethanamine (PubChem CID 62803654) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-1-(1,4-dioxan-2-yl)-N-methylmethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-1-(1,4-dioxan-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 62803654 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-(cyclohepten-1-yl)-1-(1,4-dioxan-2-yl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCCC1)C1COCCO1 |
| InChI | InChI=1S/C13H23NO2/c1-14-13(12-10-15-8-9-16-12)11-6-4-2-3-5-7-11/h6,12-14H,2-5,7-10H2,1H3 |
| InChIKey | DIAPINXDADGDFB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|