C13H23NO — CID 62212633
1-(cyclohexen-1-yl)-N-methyl-1-(oxan-2-yl)methanamine (PubChem CID 62212633) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-methyl-1-(oxan-2-yl)methanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-methyl-1-(oxan-2-yl)methanamine |
|---|---|
| PubChem CID | 62212633 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-methyl-1-(oxan-2-yl)methanamine |
| SMILES | CNC(C1=CCCCC1)C1CCCCO1 |
| InChI | InChI=1S/C13H23NO/c1-14-13(11-7-3-2-4-8-11)12-9-5-6-10-15-12/h7,12-14H,2-6,8-10H2,1H3 |
| InChIKey | JBEMLAACGIOQPO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|