C13H21F4NO — CID 106654847
1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine (PubChem CID 106654847) has the molecular formula C13H21F4NO and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine.
| Compound Name | 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
|---|---|
| PubChem CID | 106654847 |
| Molecular Formula | C13H21F4NO |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-N-ethyl-2-(2,2,3,3-tetrafluoropropoxy)ethanamine |
| SMILES | CCNC(COCC(F)(F)C(F)F)C1=CCCCC1 |
| InChI | InChI=1S/C13H21F4NO/c1-2-18-11(10-6-4-3-5-7-10)8-19-9-13(16,17)12(14)15/h6,11-12,18H,2-5,7-9H2,1H3 |
| InChIKey | RJJRCZYCULAUPW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|