C14H19BrN2S — CID 62803742
4-(3-bromophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)butanenitrile (PubChem CID 62803742) has the molecular formula C14H19BrN2S and a molecular weight of 327.29 g/mol. Its IUPAC name is 4-(3-bromophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)butanenitrile.
| Compound Name | 4-(3-bromophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)butanenitrile |
|---|---|
| PubChem CID | 62803742 |
| Molecular Formula | C14H19BrN2S |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 4-(3-bromophenyl)sulfanyl-2-methyl-2-(propan-2-ylamino)butanenitrile |
| SMILES | CC(C)NC(C)(C#N)CCSc1cccc(Br)c1 |
| InChI | InChI=1S/C14H19BrN2S/c1-11(2)17-14(3,10-16)7-8-18-13-6-4-5-12(15)9-13/h4-6,9,11,17H,7-8H2,1-3H3 |
| InChIKey | FSOYEMIJNOWUJL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |