C16H31N3O — CID 62808201
3-(aminomethyl)-N-[2-(azepan-1-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 62808201) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-(azepan-1-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 3-(aminomethyl)-N-[2-(azepan-1-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 62808201 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 3-(aminomethyl)-N-[2-(azepan-1-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | NCC1CCCC(C(=O)NCCN2CCCCCC2)C1 |
| InChI | InChI=1S/C16H31N3O/c17-13-14-6-5-7-15(12-14)16(20)18-8-11-19-9-3-1-2-4-10-19/h14-15H,1-13,17H2,(H,18,20) |
| InChIKey | WXHFUOMNFVXMOA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |