C13H10F3N3S — CID 62810852
2,3,5-trifluoro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline (PubChem CID 62810852) has the molecular formula C13H10F3N3S and a molecular weight of 297.31 g/mol. Its IUPAC name is 2,3,5-trifluoro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline.
| Compound Name | 2,3,5-trifluoro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 62810852 |
| Molecular Formula | C13H10F3N3S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2,3,5-trifluoro-N-[(6-methylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]aniline |
| SMILES | Cc1nc2sccn2c1CNc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H10F3N3S/c1-7-11(19-2-3-20-13(19)18-7)6-17-10-5-8(14)4-9(15)12(10)16/h2-5,17H,6H2,1H3 |
| InChIKey | WAZKXOLMVZSGCX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|