C13H9BrF3N3O — CID 62812436
5-bromo-2-(methylamino)-N-(2,3,5-trifluorophenyl)pyridine-3-carboxamide (PubChem CID 62812436) has the molecular formula C13H9BrF3N3O and a molecular weight of 360.13 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-(2,3,5-trifluorophenyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-(methylamino)-N-(2,3,5-trifluorophenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62812436 |
| Molecular Formula | C13H9BrF3N3O |
| Molecular Weight | 360.13 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-(2,3,5-trifluorophenyl)pyridine-3-carboxamide |
| SMILES | CNc1ncc(Br)cc1C(=O)Nc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H9BrF3N3O/c1-18-12-8(2-6(14)5-19-12)13(21)20-10-4-7(15)3-9(16)11(10)17/h2-5H,1H3,(H,18,19)(H,20,21) |
| InChIKey | HSPVCWLDVBVWEH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.13 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|