C15H15F3N2 — CID 62812766
2-methyl-1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 62812766) has the molecular formula C15H15F3N2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 2-methyl-1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 2-methyl-1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 62812766 |
| Molecular Formula | C15H15F3N2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-methyl-1-(3,4,5-trifluorophenyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | Cc1cc2c(n1-c1cc(F)c(F)c(F)c1)CCCC2N |
| InChI | InChI=1S/C15H15F3N2/c1-8-5-10-13(19)3-2-4-14(10)20(8)9-6-11(16)15(18)12(17)7-9/h5-7,13H,2-4,19H2,1H3 |
| InChIKey | WJXGZDJMDGGIFB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|