C12H10F3NS — CID 62813910
N-methyl-1-[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methanamine (PubChem CID 62813910) has the molecular formula C12H10F3NS and a molecular weight of 257.28 g/mol. Its IUPAC name is N-methyl-1-[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 62813910 |
| Molecular Formula | C12H10F3NS |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-methyl-1-[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methanamine |
| SMILES | CNCc1ccc(-c2cc(F)cc(F)c2F)s1 |
| InChI | InChI=1S/C12H10F3NS/c1-16-6-8-2-3-11(17-8)9-4-7(13)5-10(14)12(9)15/h2-5,16H,6H2,1H3 |
| InChIKey | DDZYHBWAFBYMKB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|