C14H14F3NS — CID 62814253
N-[[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 62814253) has the molecular formula C14H14F3NS and a molecular weight of 285.33 g/mol. Its IUPAC name is N-[[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62814253 |
| Molecular Formula | C14H14F3NS |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | N-[[5-(2,3,5-trifluorophenyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(-c2cc(F)cc(F)c2F)s1 |
| InChI | InChI=1S/C14H14F3NS/c1-8(2)18-7-10-3-4-13(19-10)11-5-9(15)6-12(16)14(11)17/h3-6,8,18H,7H2,1-2H3 |
| InChIKey | DPYUJUHUUNNPKR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|