C13H20N4O3 — CID 62816340
5-amino-1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl]pyridin-2-one (PubChem CID 62816340) has the molecular formula C13H20N4O3 and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-amino-1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl]pyridin-2-one.
| Compound Name | 5-amino-1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl]pyridin-2-one |
|---|---|
| PubChem CID | 62816340 |
| Molecular Formula | C13H20N4O3 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 5-amino-1-[2-[4-(2-hydroxyethyl)piperazin-1-yl]-2-oxoethyl]pyridin-2-one |
| SMILES | Nc1ccc(=O)n(CC(=O)N2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C13H20N4O3/c14-11-1-2-12(19)17(9-11)10-13(20)16-5-3-15(4-6-16)7-8-18/h1-2,9,18H,3-8,10,14H2 |
| InChIKey | YQJOCFQMBBPIEH-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |