C11H18N4O3 — CID 62820413
2-[ethyl-[(1-methylpyrazol-4-yl)carbamoyl]amino]-2-methylpropanoic acid (PubChem CID 62820413) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-[ethyl-[(1-methylpyrazol-4-yl)carbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 2-[ethyl-[(1-methylpyrazol-4-yl)carbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62820413 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[ethyl-[(1-methylpyrazol-4-yl)carbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(C(=O)Nc1cnn(C)c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C11H18N4O3/c1-5-15(11(2,3)9(16)17)10(18)13-8-6-12-14(4)7-8/h6-7H,5H2,1-4H3,(H,13,18)(H,16,17) |
| InChIKey | DZJGEBCYKMRWBS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |