C14H21NO3 — CID 62820736
2-methyl-2-[methyl(3-phenoxypropyl)amino]propanoic acid (PubChem CID 62820736) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-methyl-2-[methyl(3-phenoxypropyl)amino]propanoic acid.
| Compound Name | 2-methyl-2-[methyl(3-phenoxypropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 62820736 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-methyl-2-[methyl(3-phenoxypropyl)amino]propanoic acid |
| SMILES | CN(CCCOc1ccccc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H21NO3/c1-14(2,13(16)17)15(3)10-7-11-18-12-8-5-4-6-9-12/h4-6,8-9H,7,10-11H2,1-3H3,(H,16,17) |
| InChIKey | DMYURSCPFSQTCN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|