C13H16ClN3O3 — CID 62823041
2-[4-(4-chloropyridine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823041) has the molecular formula C13H16ClN3O3 and a molecular weight of 297.74 g/mol. Its IUPAC name is 2-[4-(4-chloropyridine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(4-chloropyridine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62823041 |
| Molecular Formula | C13H16ClN3O3 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 2-[4-(4-chloropyridine-2-carbonyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)c2cc(Cl)ccn2)CC1 |
| InChI | InChI=1S/C13H16ClN3O3/c14-10-2-3-15-11(8-10)13(20)17-5-1-4-16(6-7-17)9-12(18)19/h2-3,8H,1,4-7,9H2,(H,18,19) |
| InChIKey | ILFKHOQSWPHLSN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |