C14H16Cl2N2O3 — CID 62823375
2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823375) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62823375 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-11-6-10(7-12(16)8-11)14(21)18-3-1-2-17(4-5-18)9-13(19)20/h6-8H,1-5,9H2,(H,19,20) |
| InChIKey | XGOXSWMHBQMWPV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |