2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid

C14H16Cl2N2O3 — CID 62823375

IUPAC2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1
InChIInChI=1S/C14H16Cl2N2O3/c15-11-6-10(7-12(16)8-11)14(21)18-3-1-2-17(4-5-18)9-13(19)20/h6-8H,1-5,9H2,(H,19,20)
InChIKeyXGOXSWMHBQMWPV-UHFFFAOYSA-N
MW331.20 g/mol
LogP2.23
Rot. Bonds3

About 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid

2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62823375) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid
PubChem CID62823375
Molecular FormulaC14H16Cl2N2O3
Molecular Weight331.20 g/mol
Exact Mass330.05
IUPAC Name2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1
InChIInChI=1S/C14H16Cl2N2O3/c15-11-6-10(7-12(16)8-11)14(21)18-3-1-2-17(4-5-18)9-13(19)20/h6-8H,1-5,9H2,(H,19,20)
InChIKeyXGOXSWMHBQMWPV-UHFFFAOYSA-N
XLogP2.23
TPSA60.85 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.20
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid (CID 62823375) is 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid?
The InChIKey is XGOXSWMHBQMWPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16Cl2N2O3/c15-11-6-10(7-12(16)8-11)14(21)18-3-1-2-17(4-5-18)9-13(19)20/h6-8H,1-5,9H2,(H,19,20).
What are the key properties of 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid?
2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid has a molecular weight of 331.20 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,5-dichlorobenzoyl)-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62823375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).