C16H11BrF2N2 — CID 62823178
2-bromo-4,6-difluoro-N-(isoquinolin-5-ylmethyl)aniline (PubChem CID 62823178) has the molecular formula C16H11BrF2N2 and a molecular weight of 349.18 g/mol. Its IUPAC name is 2-bromo-4,6-difluoro-N-(isoquinolin-5-ylmethyl)aniline.
| Compound Name | 2-bromo-4,6-difluoro-N-(isoquinolin-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 62823178 |
| Molecular Formula | C16H11BrF2N2 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-bromo-4,6-difluoro-N-(isoquinolin-5-ylmethyl)aniline |
| SMILES | Fc1cc(F)c(NCc2cccc3cnccc23)c(Br)c1 |
| InChI | InChI=1S/C16H11BrF2N2/c17-14-6-12(18)7-15(19)16(14)21-9-11-3-1-2-10-8-20-5-4-13(10)11/h1-8,21H,9H2 |
| InChIKey | NOCFZBKOKBJGOR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |