C12H23N3O4 — CID 62825560
3-[[1-(dimethylamino)-1-oxopropan-2-yl]carbamoyl-ethylamino]butanoic acid (PubChem CID 62825560) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-[[1-(dimethylamino)-1-oxopropan-2-yl]carbamoyl-ethylamino]butanoic acid.
| Compound Name | 3-[[1-(dimethylamino)-1-oxopropan-2-yl]carbamoyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 62825560 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-[[1-(dimethylamino)-1-oxopropan-2-yl]carbamoyl-ethylamino]butanoic acid |
| SMILES | CCN(C(=O)NC(C)C(=O)N(C)C)C(C)CC(=O)O |
| InChI | InChI=1S/C12H23N3O4/c1-6-15(8(2)7-10(16)17)12(19)13-9(3)11(18)14(4)5/h8-9H,6-7H2,1-5H3,(H,13,19)(H,16,17) |
| InChIKey | YGQURFZZJNXCIT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |