C9H8BrN3S — CID 62829306
3-[(2-bromophenyl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 62829306) has the molecular formula C9H8BrN3S and a molecular weight of 270.16 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[(2-bromophenyl)methyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 62829306 |
| Molecular Formula | C9H8BrN3S |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 268.96 |
| IUPAC Name | 3-[(2-bromophenyl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(Cc2ccccc2Br)ns1 |
| InChI | InChI=1S/C9H8BrN3S/c10-7-4-2-1-3-6(7)5-8-12-9(11)14-13-8/h1-4H,5H2,(H2,11,12,13) |
| InChIKey | LMNHCSKPTJFGLV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |