C9H20N2 — CID 62832769
1-N-cyclopropyl-3-N-ethylbutane-1,3-diamine (PubChem CID 62832769) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-N-cyclopropyl-3-N-ethylbutane-1,3-diamine.
| Compound Name | 1-N-cyclopropyl-3-N-ethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 62832769 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1-N-cyclopropyl-3-N-ethylbutane-1,3-diamine |
| SMILES | CCNC(C)CCNC1CC1 |
| InChI | InChI=1S/C9H20N2/c1-3-10-8(2)6-7-11-9-4-5-9/h8-11H,3-7H2,1-2H3 |
| InChIKey | MHVQHKXXVLBGIF-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |