C14H28N4O2 — CID 62837069
N-ethyl-2-[4-[3-(ethylamino)butanoyl]piperazin-1-yl]acetamide (PubChem CID 62837069) has the molecular formula C14H28N4O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is N-ethyl-2-[4-[3-(ethylamino)butanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-ethyl-2-[4-[3-(ethylamino)butanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 62837069 |
| Molecular Formula | C14H28N4O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | N-ethyl-2-[4-[3-(ethylamino)butanoyl]piperazin-1-yl]acetamide |
| SMILES | CCNC(=O)CN1CCN(C(=O)CC(C)NCC)CC1 |
| InChI | InChI=1S/C14H28N4O2/c1-4-15-12(3)10-14(20)18-8-6-17(7-9-18)11-13(19)16-5-2/h12,15H,4-11H2,1-3H3,(H,16,19) |
| InChIKey | LPYIQTPNNRJPGE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |