About 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one
3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one (PubChem CID 62838357) has the molecular formula C12H22F3N3O
and a molecular weight of 281.32 g/mol. Its IUPAC name is 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one |
| PubChem CID | 62838357 |
| Molecular Formula | C12H22F3N3O |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one |
| SMILES | CCNC(C)CC(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3O/c1-3-16-10(2)8-11(19)18-6-4-17(5-7-18)9-12(13,14)15/h10,16H,3-9H2,1-2H3 |
| InChIKey | ZQNZYEVHBOYSGL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one?
The IUPAC name of 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one (CID 62838357) is 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one.
What is the SMILES notation for 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one?
The canonical SMILES for 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one is CCNC(C)CC(=O)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one?
The InChIKey is ZQNZYEVHBOYSGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3N3O/c1-3-16-10(2)8-11(19)18-6-4-17(5-7-18)9-12(13,14)15/h10,16H,3-9H2,1-2H3.
What are the key properties of 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one?
3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one has a molecular weight of 281.32 g/mol, XLogP of 1.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylamino)-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]butan-1-one is sourced from PubChem (CID 62838357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).