C17H27N3O — CID 62839015
2-(1,4-diazepan-1-yl)-N-[1-(2,4-dimethylphenyl)ethyl]acetamide (PubChem CID 62839015) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-[1-(2,4-dimethylphenyl)ethyl]acetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-[1-(2,4-dimethylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 62839015 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-[1-(2,4-dimethylphenyl)ethyl]acetamide |
| SMILES | Cc1ccc(C(C)NC(=O)CN2CCCNCC2)c(C)c1 |
| InChI | InChI=1S/C17H27N3O/c1-13-5-6-16(14(2)11-13)15(3)19-17(21)12-20-9-4-7-18-8-10-20/h5-6,11,15,18H,4,7-10,12H2,1-3H3,(H,19,21) |
| InChIKey | LMPPZUVFWFBVKL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |