C15H22N4O2 — CID 62839603
3-[[[2-(1,4-diazepan-1-yl)acetyl]amino]methyl]benzamide (PubChem CID 62839603) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[[[2-(1,4-diazepan-1-yl)acetyl]amino]methyl]benzamide.
| Compound Name | 3-[[[2-(1,4-diazepan-1-yl)acetyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 62839603 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[[[2-(1,4-diazepan-1-yl)acetyl]amino]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNC(=O)CN2CCCNCC2)c1 |
| InChI | InChI=1S/C15H22N4O2/c16-15(21)13-4-1-3-12(9-13)10-18-14(20)11-19-7-2-5-17-6-8-19/h1,3-4,9,17H,2,5-8,10-11H2,(H2,16,21)(H,18,20) |
| InChIKey | RUXVQZFCFVBNIV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |