C10H12N2O2S — CID 62840128
3-(1-thiophen-3-ylethylamino)pyrrolidine-2,5-dione (PubChem CID 62840128) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-(1-thiophen-3-ylethylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1-thiophen-3-ylethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 62840128 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 3-(1-thiophen-3-ylethylamino)pyrrolidine-2,5-dione |
| SMILES | CC(NC1CC(=O)NC1=O)c1ccsc1 |
| InChI | InChI=1S/C10H12N2O2S/c1-6(7-2-3-15-5-7)11-8-4-9(13)12-10(8)14/h2-3,5-6,8,11H,4H2,1H3,(H,12,13,14) |
| InChIKey | DKMCAPVXGIUZBV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|