C15H25NO3S — CID 62840143
1-(2-ethoxyethoxy)-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)propan-2-ol (PubChem CID 62840143) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(2-ethoxyethoxy)-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)propan-2-ol.
| Compound Name | 1-(2-ethoxyethoxy)-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 62840143 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-(2-ethoxyethoxy)-3-(4,5,6,7-tetrahydro-1-benzothiophen-4-ylamino)propan-2-ol |
| SMILES | CCOCCOCC(O)CNC1CCCc2sccc21 |
| InChI | InChI=1S/C15H25NO3S/c1-2-18-7-8-19-11-12(17)10-16-14-4-3-5-15-13(14)6-9-20-15/h6,9,12,14,16-17H,2-5,7-8,10-11H2,1H3 |
| InChIKey | DJQFQVLSKGLRHG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|