C15H18N2O2S2 — CID 62840863
N-cyclopropyl-2-(1-thiophen-3-ylethylamino)benzenesulfonamide (PubChem CID 62840863) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-cyclopropyl-2-(1-thiophen-3-ylethylamino)benzenesulfonamide.
| Compound Name | N-cyclopropyl-2-(1-thiophen-3-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 62840863 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-cyclopropyl-2-(1-thiophen-3-ylethylamino)benzenesulfonamide |
| SMILES | CC(Nc1ccccc1S(=O)(=O)NC1CC1)c1ccsc1 |
| InChI | InChI=1S/C15H18N2O2S2/c1-11(12-8-9-20-10-12)16-14-4-2-3-5-15(14)21(18,19)17-13-6-7-13/h2-5,8-11,13,16-17H,6-7H2,1H3 |
| InChIKey | NCDDCCLKAGDMEU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |