C16H19N3S2 — CID 62841992
N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine (PubChem CID 62841992) has the molecular formula C16H19N3S2 and a molecular weight of 317.48 g/mol. Its IUPAC name is N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine.
| Compound Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
|---|---|
| PubChem CID | 62841992 |
| Molecular Formula | C16H19N3S2 |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-4,5,6,7-tetrahydro-1-benzothiophen-4-amine |
| SMILES | Cc1cn2c(CNC3CCCc4sccc43)c(C)nc2s1 |
| InChI | InChI=1S/C16H19N3S2/c1-10-9-19-14(11(2)18-16(19)21-10)8-17-13-4-3-5-15-12(13)6-7-20-15/h6-7,9,13,17H,3-5,8H2,1-2H3 |
| InChIKey | FMJYTKFZYYETRY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |