C13H18FN3O2 — CID 62845784
N-(3-acetamido-4-fluorophenyl)-2-methyl-2-(methylamino)propanamide (PubChem CID 62845784) has the molecular formula C13H18FN3O2 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-(3-acetamido-4-fluorophenyl)-2-methyl-2-(methylamino)propanamide.
| Compound Name | N-(3-acetamido-4-fluorophenyl)-2-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 62845784 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-(3-acetamido-4-fluorophenyl)-2-methyl-2-(methylamino)propanamide |
| SMILES | CNC(C)(C)C(=O)Nc1ccc(F)c(NC(C)=O)c1 |
| InChI | InChI=1S/C13H18FN3O2/c1-8(18)16-11-7-9(5-6-10(11)14)17-12(19)13(2,3)15-4/h5-7,15H,1-4H3,(H,16,18)(H,17,19) |
| InChIKey | WJPNTIOSUWCYFB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |