C15H23N3O3 — CID 62852293
3-[ethyl-[[2-(methylaminomethyl)phenyl]carbamoyl]amino]-2-methylpropanoic acid (PubChem CID 62852293) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[ethyl-[[2-(methylaminomethyl)phenyl]carbamoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[ethyl-[[2-(methylaminomethyl)phenyl]carbamoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62852293 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[ethyl-[[2-(methylaminomethyl)phenyl]carbamoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)Nc1ccccc1CNC |
| InChI | InChI=1S/C15H23N3O3/c1-4-18(10-11(2)14(19)20)15(21)17-13-8-6-5-7-12(13)9-16-3/h5-8,11,16H,4,9-10H2,1-3H3,(H,17,21)(H,19,20) |
| InChIKey | QLRUEDSKVIIJKV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |