C14H16F3NO2 — CID 62856621
2-[cyclobutylmethyl(methyl)amino]-5-(trifluoromethyl)benzoic acid (PubChem CID 62856621) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-[cyclobutylmethyl(methyl)amino]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[cyclobutylmethyl(methyl)amino]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 62856621 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[cyclobutylmethyl(methyl)amino]-5-(trifluoromethyl)benzoic acid |
| SMILES | CN(CC1CCC1)c1ccc(C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C14H16F3NO2/c1-18(8-9-3-2-4-9)12-6-5-10(14(15,16)17)7-11(12)13(19)20/h5-7,9H,2-4,8H2,1H3,(H,19,20) |
| InChIKey | ICDRZDWVMKFTGN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |