C13H14ClF4N — CID 107304112
N-[(3-chlorocyclobutyl)methyl]-2-fluoro-N-methyl-4-(trifluoromethyl)aniline (PubChem CID 107304112) has the molecular formula C13H14ClF4N and a molecular weight of 295.71 g/mol. Its IUPAC name is N-[(3-chlorocyclobutyl)methyl]-2-fluoro-N-methyl-4-(trifluoromethyl)aniline.
| Compound Name | N-[(3-chlorocyclobutyl)methyl]-2-fluoro-N-methyl-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 107304112 |
| Molecular Formula | C13H14ClF4N |
| Molecular Weight | 295.71 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(3-chlorocyclobutyl)methyl]-2-fluoro-N-methyl-4-(trifluoromethyl)aniline |
| SMILES | CN(CC1CC(Cl)C1)c1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C13H14ClF4N/c1-19(7-8-4-10(14)5-8)12-3-2-9(6-11(12)15)13(16,17)18/h2-3,6,8,10H,4-5,7H2,1H3 |
| InChIKey | PMTDZCUGVADKGB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|